C29H28O9 — CID 162459086
7-(6,7-dihydroxy-1,4-dioxo-5-propan-2-ylnaphthalen-2-yl)-2,3-dihydroxy-6,6-dimethyl-5,8-dioxo-4-propan-2-yl-7H-naphthalene-1-carbaldehyde (PubChem CID 162459086) has the molecular formula C29H28O9 and a molecular weight of 520.53 g/mol. Its IUPAC name is 7-(6,7-dihydroxy-1,4-dioxo-5-propan-2-ylnaphthalen-2-yl)-2,3-dihydroxy-6,6-dimethyl-5,8-dioxo-4-propan-2-yl-7H-naphthalene-1-carbaldehyde.
| Compound Name | 7-(6,7-dihydroxy-1,4-dioxo-5-propan-2-ylnaphthalen-2-yl)-2,3-dihydroxy-6,6-dimethyl-5,8-dioxo-4-propan-2-yl-7H-naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 162459086 |
| Molecular Formula | C29H28O9 |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 7-(6,7-dihydroxy-1,4-dioxo-5-propan-2-ylnaphthalen-2-yl)-2,3-dihydroxy-6,6-dimethyl-5,8-dioxo-4-propan-2-yl-7H-naphthalene-1-carbaldehyde |
| SMILES | CC(C)c1c(O)c(O)cc2c1C(=O)C=C(C1C(=O)c3c(C=O)c(O)c(O)c(C(C)C)c3C(=O)C1(C)C)C2=O |
| InChI | InChI=1S/C29H28O9/c1-10(2)17-19-12(7-16(32)25(17)35)23(33)13(8-15(19)31)22-26(36)20-14(9-30)24(34)27(37)18(11(3)4)21(20)28(38)29(22,5)6/h7-11,22,32,34-35,37H,1-6H3 |
| InChIKey | IUOGIWWPHCFMHT-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 166.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|