C37H50IrNO2- — CID 162459380
6-cyclopentyl-3,4-dideuterio-1-(3,5-dimethylbenzene-6-id-1-yl)isoquinoline;iridium;(Z)-3,3,7-triethyl-6-hydroxynon-5-en-4-one (PubChem CID 162459380) has the molecular formula C37H50IrNO2- and a molecular weight of 735.04 g/mol. Its IUPAC name is 6-cyclopentyl-3,4-dideuterio-1-(3,5-dimethylbenzene-6-id-1-yl)isoquinoline;iridium;(Z)-3,3,7-triethyl-6-hydroxynon-5-en-4-one.
| Compound Name | 6-cyclopentyl-3,4-dideuterio-1-(3,5-dimethylbenzene-6-id-1-yl)isoquinoline;iridium;(Z)-3,3,7-triethyl-6-hydroxynon-5-en-4-one |
|---|---|
| PubChem CID | 162459380 |
| Molecular Formula | C37H50IrNO2- |
| Molecular Weight | 735.04 g/mol |
| Exact Mass | 735.36 |
| IUPAC Name | 6-cyclopentyl-3,4-dideuterio-1-(3,5-dimethylbenzene-6-id-1-yl)isoquinoline;iridium;(Z)-3,3,7-triethyl-6-hydroxynon-5-en-4-one |
| SMILES | CCC(CC)/C(O)=C/C(=O)C(CC)(CC)CC.[2H]c1nc(-c2[c-]c(C)cc(C)c2)c2ccc(C3CCCC3)cc2c1[2H].[Ir] |
| InChI | InChI=1S/C22H22N.C15H28O2.Ir/c1-15-11-16(2)13-20(12-15)22-21-8-7-18(17-5-3-4-6-17)14-19(21)9-10-23-22;1-6-12(7-2)13(16)11-14(17)15(8-3,9-4)10-5;/h7-12,14,17H,3-6H2,1-2H3;11-12,16H,6-10H2,1-5H3;/q-1;;/b;13-11-;/i9D,10D;; |
| InChIKey | WGQFKQUYTOTCGW-KOJJWKJHSA-N |
| XLogP | 10.62 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.04 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|