About (Z)-3-fluoro-2-[[4-(1,2,4-oxadiazol-3-yl)phenoxy]methyl]prop-2-en-1-amine
(Z)-3-fluoro-2-[[4-(1,2,4-oxadiazol-3-yl)phenoxy]methyl]prop-2-en-1-amine (PubChem CID 162459620) has the molecular formula C12H12FN3O2
and a molecular weight of 249.25 g/mol. Its IUPAC name is (Z)-3-fluoro-2-[[4-(1,2,4-oxadiazol-3-yl)phenoxy]methyl]prop-2-en-1-amine.
Molecular Properties
| Compound Name | (Z)-3-fluoro-2-[[4-(1,2,4-oxadiazol-3-yl)phenoxy]methyl]prop-2-en-1-amine |
| PubChem CID | 162459620 |
| Molecular Formula | C12H12FN3O2 |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | (Z)-3-fluoro-2-[[4-(1,2,4-oxadiazol-3-yl)phenoxy]methyl]prop-2-en-1-amine |
| SMILES | NC/C(=C/F)COc1ccc(-c2ncon2)cc1 |
| InChI | InChI=1S/C12H12FN3O2/c13-5-9(6-14)7-17-11-3-1-10(2-4-11)12-15-8-18-16-12/h1-5,8H,6-7,14H2/b9-5- |
| InChIKey | BAPCECADFWGHPA-UITAMQMPSA-N |
| XLogP | 1.93 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (Z)-3-fluoro-2-[[4-(1,2,4-oxadiazol-3-yl)phenoxy]methyl]prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-fluoro-2-[[4-(1,2,4-oxadiazol-3-yl)phenoxy]methyl]prop-2-en-1-amine?
The IUPAC name of (Z)-3-fluoro-2-[[4-(1,2,4-oxadiazol-3-yl)phenoxy]methyl]prop-2-en-1-amine (CID 162459620) is (Z)-3-fluoro-2-[[4-(1,2,4-oxadiazol-3-yl)phenoxy]methyl]prop-2-en-1-amine.
What is the SMILES notation for (Z)-3-fluoro-2-[[4-(1,2,4-oxadiazol-3-yl)phenoxy]methyl]prop-2-en-1-amine?
The canonical SMILES for (Z)-3-fluoro-2-[[4-(1,2,4-oxadiazol-3-yl)phenoxy]methyl]prop-2-en-1-amine is NC/C(=C/F)COc1ccc(-c2ncon2)cc1.
What is the InChIKey of (Z)-3-fluoro-2-[[4-(1,2,4-oxadiazol-3-yl)phenoxy]methyl]prop-2-en-1-amine?
The InChIKey is BAPCECADFWGHPA-UITAMQMPSA-N. The full InChI is InChI=1S/C12H12FN3O2/c13-5-9(6-14)7-17-11-3-1-10(2-4-11)12-15-8-18-16-12/h1-5,8H,6-7,14H2/b9-5-.
What are the key properties of (Z)-3-fluoro-2-[[4-(1,2,4-oxadiazol-3-yl)phenoxy]methyl]prop-2-en-1-amine?
(Z)-3-fluoro-2-[[4-(1,2,4-oxadiazol-3-yl)phenoxy]methyl]prop-2-en-1-amine has a molecular weight of 249.25 g/mol, XLogP of 1.93, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-fluoro-2-[[4-(1,2,4-oxadiazol-3-yl)phenoxy]methyl]prop-2-en-1-amine is sourced from PubChem (CID 162459620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).