C16H14ClF4N3O5 — CID 162460152
2-[2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)-1,3-diazinan-1-yl]phenoxy]-3-oxobutanamide (PubChem CID 162460152) has the molecular formula C16H14ClF4N3O5 and a molecular weight of 439.75 g/mol. Its IUPAC name is 2-[2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)-1,3-diazinan-1-yl]phenoxy]-3-oxobutanamide.
| Compound Name | 2-[2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)-1,3-diazinan-1-yl]phenoxy]-3-oxobutanamide |
|---|---|
| PubChem CID | 162460152 |
| Molecular Formula | C16H14ClF4N3O5 |
| Molecular Weight | 439.75 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | 2-[2-chloro-4-fluoro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)-1,3-diazinan-1-yl]phenoxy]-3-oxobutanamide |
| SMILES | CC(=O)C(Oc1cc(N2C(=O)CC(C(F)(F)F)N(C)C2=O)c(F)cc1Cl)C(N)=O |
| InChI | InChI=1S/C16H14ClF4N3O5/c1-6(25)13(14(22)27)29-10-4-9(8(18)3-7(10)17)24-12(26)5-11(16(19,20)21)23(2)15(24)28/h3-4,11,13H,5H2,1-2H3,(H2,22,27) |
| InChIKey | VUIMDORPPHUKRY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.75 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|