About 3-[2-(3,3,3-trifluoropropoxy)pyrimidin-5-yl]-1H-pyridazin-6-one
3-[2-(3,3,3-trifluoropropoxy)pyrimidin-5-yl]-1H-pyridazin-6-one (PubChem CID 162460395) has the molecular formula C11H9F3N4O2
and a molecular weight of 286.21 g/mol. Its IUPAC name is 3-[2-(3,3,3-trifluoropropoxy)pyrimidin-5-yl]-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 3-[2-(3,3,3-trifluoropropoxy)pyrimidin-5-yl]-1H-pyridazin-6-one |
| PubChem CID | 162460395 |
| Molecular Formula | C11H9F3N4O2 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 3-[2-(3,3,3-trifluoropropoxy)pyrimidin-5-yl]-1H-pyridazin-6-one |
| SMILES | O=c1ccc(-c2cnc(OCCC(F)(F)F)nc2)n[nH]1 |
| InChI | InChI=1S/C11H9F3N4O2/c12-11(13,14)3-4-20-10-15-5-7(6-16-10)8-1-2-9(19)18-17-8/h1-2,5-6H,3-4H2,(H,18,19) |
| InChIKey | XGQBBSFLDXLACP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-(3,3,3-trifluoropropoxy)pyrimidin-5-yl]-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3,3,3-trifluoropropoxy)pyrimidin-5-yl]-1H-pyridazin-6-one?
The IUPAC name of 3-[2-(3,3,3-trifluoropropoxy)pyrimidin-5-yl]-1H-pyridazin-6-one (CID 162460395) is 3-[2-(3,3,3-trifluoropropoxy)pyrimidin-5-yl]-1H-pyridazin-6-one.
What is the SMILES notation for 3-[2-(3,3,3-trifluoropropoxy)pyrimidin-5-yl]-1H-pyridazin-6-one?
The canonical SMILES for 3-[2-(3,3,3-trifluoropropoxy)pyrimidin-5-yl]-1H-pyridazin-6-one is O=c1ccc(-c2cnc(OCCC(F)(F)F)nc2)n[nH]1.
What is the InChIKey of 3-[2-(3,3,3-trifluoropropoxy)pyrimidin-5-yl]-1H-pyridazin-6-one?
The InChIKey is XGQBBSFLDXLACP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F3N4O2/c12-11(13,14)3-4-20-10-15-5-7(6-16-10)8-1-2-9(19)18-17-8/h1-2,5-6H,3-4H2,(H,18,19).
What are the key properties of 3-[2-(3,3,3-trifluoropropoxy)pyrimidin-5-yl]-1H-pyridazin-6-one?
3-[2-(3,3,3-trifluoropropoxy)pyrimidin-5-yl]-1H-pyridazin-6-one has a molecular weight of 286.21 g/mol, XLogP of 1.56, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,3,3-trifluoropropoxy)pyrimidin-5-yl]-1H-pyridazin-6-one is sourced from PubChem (CID 162460395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).