C54H32N4O2Pt-2 — CID 162460833
3-[2-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-id-9-yl]-[1]benzofuro[2,3-c]pyridine;platinum (PubChem CID 162460833) has the molecular formula C54H32N4O2Pt-2 and a molecular weight of 963.95 g/mol. Its IUPAC name is 3-[2-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-id-9-yl]-[1]benzofuro[2,3-c]pyridine;platinum.
| Compound Name | 3-[2-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-id-9-yl]-[1]benzofuro[2,3-c]pyridine;platinum |
|---|---|
| PubChem CID | 162460833 |
| Molecular Formula | C54H32N4O2Pt-2 |
| Molecular Weight | 963.95 g/mol |
| Exact Mass | 963.22 |
| IUPAC Name | 3-[2-[3-[3-(2,6-diphenylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-id-9-yl]-[1]benzofuro[2,3-c]pyridine;platinum |
| SMILES | [Pt].[c-]1c(Oc2[c-]c3c(cc2)c2ccccc2n3-c2cc3c(cn2)oc2ccccc23)cccc1-n1[c-][n+](-c2c(-c3ccccc3)cccc2-c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C54H32N4O2.Pt/c1-3-15-36(16-4-1)41-23-14-24-42(37-17-5-2-6-18-37)54(41)57-35-56(48-26-10-11-27-49(48)57)38-19-13-20-39(31-38)59-40-29-30-44-43-21-7-9-25-47(43)58(50(44)32-40)53-33-46-45-22-8-12-28-51(45)60-52(46)34-55-53;/h1-30,33-34H;/q-2; |
| InChIKey | DRZJUKLEJJPSPG-UHFFFAOYSA-N |
| XLogP | 12.82 |
| TPSA | 49.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.95 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|