C15H26N4O5 — CID 162461071
1-(methoxymethyl)-2,7,10-trimethyl-1,4,7,10-tetrazacyclotetradecane-3,6,11,14-tetrone (PubChem CID 162461071) has the molecular formula C15H26N4O5 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-(methoxymethyl)-2,7,10-trimethyl-1,4,7,10-tetrazacyclotetradecane-3,6,11,14-tetrone.
| Compound Name | 1-(methoxymethyl)-2,7,10-trimethyl-1,4,7,10-tetrazacyclotetradecane-3,6,11,14-tetrone |
|---|---|
| PubChem CID | 162461071 |
| Molecular Formula | C15H26N4O5 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 1-(methoxymethyl)-2,7,10-trimethyl-1,4,7,10-tetrazacyclotetradecane-3,6,11,14-tetrone |
| SMILES | COCN1C(=O)CCC(=O)N(C)CCN(C)C(=O)CNC(=O)C1C |
| InChI | InChI=1S/C15H26N4O5/c1-11-15(23)16-9-14(22)18(3)8-7-17(2)12(20)5-6-13(21)19(11)10-24-4/h11H,5-10H2,1-4H3,(H,16,23) |
| InChIKey | RUPIICRCGWMKSE-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |