C26H32FN6O6P — CID 162461374
[4-[4-(5-acetyl-4-amino-2-fluorophenyl)-3-amino-[1,2]oxazolo[4,5-c]pyridin-7-yl]pyrazol-1-yl]methyl ditert-butyl phosphate (PubChem CID 162461374) has the molecular formula C26H32FN6O6P and a molecular weight of 574.55 g/mol. Its IUPAC name is [4-[4-(5-acetyl-4-amino-2-fluorophenyl)-3-amino-[1,2]oxazolo[4,5-c]pyridin-7-yl]pyrazol-1-yl]methyl ditert-butyl phosphate.
| Compound Name | [4-[4-(5-acetyl-4-amino-2-fluorophenyl)-3-amino-[1,2]oxazolo[4,5-c]pyridin-7-yl]pyrazol-1-yl]methyl ditert-butyl phosphate |
|---|---|
| PubChem CID | 162461374 |
| Molecular Formula | C26H32FN6O6P |
| Molecular Weight | 574.55 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | [4-[4-(5-acetyl-4-amino-2-fluorophenyl)-3-amino-[1,2]oxazolo[4,5-c]pyridin-7-yl]pyrazol-1-yl]methyl ditert-butyl phosphate |
| SMILES | CC(=O)c1cc(-c2ncc(-c3cnn(COP(=O)(OC(C)(C)C)OC(C)(C)C)c3)c3onc(N)c23)c(F)cc1N |
| InChI | InChI=1S/C26H32FN6O6P/c1-14(34)16-8-17(19(27)9-20(16)28)22-21-23(37-32-24(21)29)18(11-30-22)15-10-31-33(12-15)13-36-40(35,38-25(2,3)4)39-26(5,6)7/h8-12H,13,28H2,1-7H3,(H2,29,32) |
| InChIKey | GETYLDBUZFVPTI-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 170.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.55 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|