C19H19ClF3N3O — CID 162461682
8-chloro-1-[4-(2,2,2-trifluoroethyl)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1]benzazepin-5-one (PubChem CID 162461682) has the molecular formula C19H19ClF3N3O and a molecular weight of 397.83 g/mol. Its IUPAC name is 8-chloro-1-[4-(2,2,2-trifluoroethyl)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1]benzazepin-5-one.
| Compound Name | 8-chloro-1-[4-(2,2,2-trifluoroethyl)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1]benzazepin-5-one |
|---|---|
| PubChem CID | 162461682 |
| Molecular Formula | C19H19ClF3N3O |
| Molecular Weight | 397.83 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 8-chloro-1-[4-(2,2,2-trifluoroethyl)cyclohexyl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1]benzazepin-5-one |
| SMILES | O=C1Cc2cc(Cl)ccc2-n2c(nnc2C2CCC(CC(F)(F)F)CC2)C1 |
| InChI | InChI=1S/C19H19ClF3N3O/c20-14-5-6-16-13(7-14)8-15(27)9-17-24-25-18(26(16)17)12-3-1-11(2-4-12)10-19(21,22)23/h5-7,11-12H,1-4,8-10H2 |
| InChIKey | GKQOUPVVPZXSKF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.83 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |