About lithium [2-(2-methyl-1,3-oxazol-5-yl)acetyl]azanium
lithium [2-(2-methyl-1,3-oxazol-5-yl)acetyl]azanium (PubChem CID 162462451) has the molecular formula C6H9LiN2O2+2
and a molecular weight of 148.09 g/mol. Its IUPAC name is lithium [2-(2-methyl-1,3-oxazol-5-yl)acetyl]azanium.
Molecular Properties
| Compound Name | lithium [2-(2-methyl-1,3-oxazol-5-yl)acetyl]azanium |
| PubChem CID | 162462451 |
| Molecular Formula | C6H9LiN2O2+2 |
| Molecular Weight | 148.09 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | lithium [2-(2-methyl-1,3-oxazol-5-yl)acetyl]azanium |
| SMILES | Cc1ncc(CC([NH3+])=O)o1.[Li+] |
| InChI | InChI=1S/C6H8N2O2.Li/c1-4-8-3-5(10-4)2-6(7)9;/h3H,2H2,1H3,(H2,7,9);/q;+1/p+1 |
| InChIKey | SCXPTZNPDPYZAV-UHFFFAOYSA-O |
| XLogP | -3.70 |
| TPSA | 70.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.09 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze lithium [2-(2-methyl-1,3-oxazol-5-yl)acetyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium [2-(2-methyl-1,3-oxazol-5-yl)acetyl]azanium?
The IUPAC name of lithium [2-(2-methyl-1,3-oxazol-5-yl)acetyl]azanium (CID 162462451) is lithium [2-(2-methyl-1,3-oxazol-5-yl)acetyl]azanium.
What is the SMILES notation for lithium [2-(2-methyl-1,3-oxazol-5-yl)acetyl]azanium?
The canonical SMILES for lithium [2-(2-methyl-1,3-oxazol-5-yl)acetyl]azanium is Cc1ncc(CC([NH3+])=O)o1.[Li+].
What is the InChIKey of lithium [2-(2-methyl-1,3-oxazol-5-yl)acetyl]azanium?
The InChIKey is SCXPTZNPDPYZAV-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H8N2O2.Li/c1-4-8-3-5(10-4)2-6(7)9;/h3H,2H2,1H3,(H2,7,9);/q;+1/p+1.
What are the key properties of lithium [2-(2-methyl-1,3-oxazol-5-yl)acetyl]azanium?
lithium [2-(2-methyl-1,3-oxazol-5-yl)acetyl]azanium has a molecular weight of 148.09 g/mol, XLogP of -3.70, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium [2-(2-methyl-1,3-oxazol-5-yl)acetyl]azanium is sourced from PubChem (CID 162462451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).