C10H8N4Te — CID 162462583
4,9-dimethyl-[1,2,5]telluradiazolo[3,4-g]quinoxaline (PubChem CID 162462583) has the molecular formula C10H8N4Te and a molecular weight of 311.80 g/mol. Its IUPAC name is 4,9-dimethyl-[1,2,5]telluradiazolo[3,4-g]quinoxaline.
| Compound Name | 4,9-dimethyl-[1,2,5]telluradiazolo[3,4-g]quinoxaline |
|---|---|
| PubChem CID | 162462583 |
| Molecular Formula | C10H8N4Te |
| Molecular Weight | 311.80 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 4,9-dimethyl-[1,2,5]telluradiazolo[3,4-g]quinoxaline |
| SMILES | Cc1c2nccnc2c(C)c2n[te]nc12 |
| InChI | InChI=1S/C10H8N4Te/c1-5-7-8(12-4-3-11-7)6(2)10-9(5)13-15-14-10/h3-4H,1-2H3 |
| InChIKey | CFKYNRFRARIJTN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.80 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|