C22H39NO5 — CID 162462693
1-[4-[bis(oxiran-2-ylmethyl)amino]cyclohexyl]oxy-3-(4-methylcyclohexyl)oxypropan-2-ol (PubChem CID 162462693) has the molecular formula C22H39NO5 and a molecular weight of 397.56 g/mol. Its IUPAC name is 1-[4-[bis(oxiran-2-ylmethyl)amino]cyclohexyl]oxy-3-(4-methylcyclohexyl)oxypropan-2-ol.
| Compound Name | 1-[4-[bis(oxiran-2-ylmethyl)amino]cyclohexyl]oxy-3-(4-methylcyclohexyl)oxypropan-2-ol |
|---|---|
| PubChem CID | 162462693 |
| Molecular Formula | C22H39NO5 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | 1-[4-[bis(oxiran-2-ylmethyl)amino]cyclohexyl]oxy-3-(4-methylcyclohexyl)oxypropan-2-ol |
| SMILES | CC1CCC(OCC(O)COC2CCC(N(CC3CO3)CC3CO3)CC2)CC1 |
| InChI | InChI=1S/C22H39NO5/c1-16-2-6-19(7-3-16)25-12-18(24)13-26-20-8-4-17(5-9-20)23(10-21-14-27-21)11-22-15-28-22/h16-22,24H,2-15H2,1H3 |
| InChIKey | HHFAOEUBIMBBOU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 66.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|