C24H49N7O — CID 162462836
2-[(3R,5S)-3,5-diaminopiperidin-1-yl]-4-[(3,5-ditert-butylcyclohexyl)amino]-1,3-diazinane-5-carboxamide (PubChem CID 162462836) has the molecular formula C24H49N7O and a molecular weight of 451.70 g/mol. Its IUPAC name is 2-[(3R,5S)-3,5-diaminopiperidin-1-yl]-4-[(3,5-ditert-butylcyclohexyl)amino]-1,3-diazinane-5-carboxamide.
| Compound Name | 2-[(3R,5S)-3,5-diaminopiperidin-1-yl]-4-[(3,5-ditert-butylcyclohexyl)amino]-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 162462836 |
| Molecular Formula | C24H49N7O |
| Molecular Weight | 451.70 g/mol |
| Exact Mass | 451.40 |
| IUPAC Name | 2-[(3R,5S)-3,5-diaminopiperidin-1-yl]-4-[(3,5-ditert-butylcyclohexyl)amino]-1,3-diazinane-5-carboxamide |
| SMILES | CC(C)(C)C1CC(NC2NC(N3C[C@H](N)C[C@H](N)C3)NCC2C(N)=O)CC(C(C)(C)C)C1 |
| InChI | InChI=1S/C24H49N7O/c1-23(2,3)14-7-15(24(4,5)6)9-18(8-14)29-21-19(20(27)32)11-28-22(30-21)31-12-16(25)10-17(26)13-31/h14-19,21-22,28-30H,7-13,25-26H2,1-6H3,(H2,27,32)/t14?,15?,16-,17+,18?,19?,21?,22? |
| InChIKey | PLSWGAHZTDHYFH-PMIYHRPUSA-N |
| XLogP | 0.72 |
| TPSA | 134.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.70 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |