About CID 162463176
CID 162463176 (PubChem CID 162463176) has the molecular formula C23H17AsIrN2O-
and a molecular weight of 604.54 g/mol.
Molecular Properties
| Compound Name | CID 162463176 |
| PubChem CID | 162463176 |
| Molecular Formula | C23H17AsIrN2O- |
| Molecular Weight | 604.54 g/mol |
| Exact Mass | 605.02 |
| IUPAC Name | — |
| SMILES | Cc1nn(-c2[c-]cccc2)c(C)c1-c1ccc2c(c1)-c1ccccc1[As]2=O.[Ir] |
| InChI | InChI=1S/C23H17AsN2O.Ir/c1-15-23(16(2)26(25-15)18-8-4-3-5-9-18)17-12-13-22-20(14-17)19-10-6-7-11-21(19)24(22)27;/h3-8,10-14H,1-2H3;/q-1; |
| InChIKey | ANYDPMYSIWRCDE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 604.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 162463176 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162463176?
The IUPAC name of CID 162463176 (CID 162463176) is not available.
What is the SMILES notation for CID 162463176?
The canonical SMILES for CID 162463176 is Cc1nn(-c2[c-]cccc2)c(C)c1-c1ccc2c(c1)-c1ccccc1[As]2=O.[Ir].
What is the InChIKey of CID 162463176?
The InChIKey is ANYDPMYSIWRCDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17AsN2O.Ir/c1-15-23(16(2)26(25-15)18-8-4-3-5-9-18)17-12-13-22-20(14-17)19-10-6-7-11-21(19)24(22)27;/h3-8,10-14H,1-2H3;/q-1;.
What are the key properties of CID 162463176?
CID 162463176 has a molecular weight of 604.54 g/mol, XLogP of 3.47, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162463176 is sourced from PubChem (CID 162463176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).