C93H141O3P — CID 162463842
tris[bis[3-(2,2,4,4-tetramethylpentan-3-yl)phenyl]methyl] phosphite (PubChem CID 162463842) has the molecular formula C93H141O3P and a molecular weight of 1338.12 g/mol. Its IUPAC name is tris[bis[3-(2,2,4,4-tetramethylpentan-3-yl)phenyl]methyl] phosphite.
| Compound Name | tris[bis[3-(2,2,4,4-tetramethylpentan-3-yl)phenyl]methyl] phosphite |
|---|---|
| PubChem CID | 162463842 |
| Molecular Formula | C93H141O3P |
| Molecular Weight | 1338.12 g/mol |
| Exact Mass | 1337.06 |
| IUPAC Name | tris[bis[3-(2,2,4,4-tetramethylpentan-3-yl)phenyl]methyl] phosphite |
| SMILES | CC(C)(C)C(c1cccc(C(OP(OC(c2cccc(C(C(C)(C)C)C(C)(C)C)c2)c2cccc(C(C(C)(C)C)C(C)(C)C)c2)OC(c2cccc(C(C(C)(C)C)C(C)(C)C)c2)c2cccc(C(C(C)(C)C)C(C)(C)C)c2)c2cccc(C(C(C)(C)C)C(C)(C)C)c2)c1)C(C)(C)C |
| InChI | InChI=1S/C93H141O3P/c1-82(2,3)76(83(4,5)6)67-49-37-43-61(55-67)73(62-44-38-50-68(56-62)77(84(7,8)9)85(10,11)12)94-97(95-74(63-45-39-51-69(57-63)78(86(13,14)15)87(16,17)18)64-46-40-52-70(58-64)79(88(19,20)21)89(22,23)24)96-75(65-47-41-53-71(59-65)80(90(25,26)27)91(28,29)30)66-48-42-54-72(60-66)81(92(31,32)33)93(34,35)36/h37-60,73-81H,1-36H3 |
| InChIKey | RQQFFBQZDQECRV-UHFFFAOYSA-N |
| XLogP | 29.69 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 97 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1338.12 |
| LogP ≤ 5 | 29.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|