C23H27F4N3O3S — CID 162464241
(2S,3R)-3-(cyclopropylsulfonylamino)-2-[(1,6-difluoro-5-phenylcyclohexa-2,4-dien-1-yl)methyl]-4,4-difluoro-N,N-dimethylpyrrolidine-1-carboxamide (PubChem CID 162464241) has the molecular formula C23H27F4N3O3S and a molecular weight of 501.55 g/mol. Its IUPAC name is (2S,3R)-3-(cyclopropylsulfonylamino)-2-[(1,6-difluoro-5-phenylcyclohexa-2,4-dien-1-yl)methyl]-4,4-difluoro-N,N-dimethylpyrrolidine-1-carboxamide.
| Compound Name | (2S,3R)-3-(cyclopropylsulfonylamino)-2-[(1,6-difluoro-5-phenylcyclohexa-2,4-dien-1-yl)methyl]-4,4-difluoro-N,N-dimethylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 162464241 |
| Molecular Formula | C23H27F4N3O3S |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | (2S,3R)-3-(cyclopropylsulfonylamino)-2-[(1,6-difluoro-5-phenylcyclohexa-2,4-dien-1-yl)methyl]-4,4-difluoro-N,N-dimethylpyrrolidine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CC(F)(F)[C@H](NS(=O)(=O)C2CC2)[C@@H]1CC1(F)C=CC=C(c2ccccc2)C1F |
| InChI | InChI=1S/C23H27F4N3O3S/c1-29(2)21(31)30-14-23(26,27)20(28-34(32,33)16-10-11-16)18(30)13-22(25)12-6-9-17(19(22)24)15-7-4-3-5-8-15/h3-9,12,16,18-20,28H,10-11,13-14H2,1-2H3/t18-,19?,20+,22?/m0/s1 |
| InChIKey | UJDPNRMLDOVXRG-SFHMGJLPSA-N |
| XLogP | 3.53 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |