C20H20F2N6O2 — CID 162464942
6-amino-N-[3-(difluoromethyl)-1-(4-formylcyclohexyl)pyrazol-4-yl]-1,5-naphthyridine-4-carboxamide (PubChem CID 162464942) has the molecular formula C20H20F2N6O2 and a molecular weight of 414.42 g/mol. Its IUPAC name is 6-amino-N-[3-(difluoromethyl)-1-(4-formylcyclohexyl)pyrazol-4-yl]-1,5-naphthyridine-4-carboxamide.
| Compound Name | 6-amino-N-[3-(difluoromethyl)-1-(4-formylcyclohexyl)pyrazol-4-yl]-1,5-naphthyridine-4-carboxamide |
|---|---|
| PubChem CID | 162464942 |
| Molecular Formula | C20H20F2N6O2 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 6-amino-N-[3-(difluoromethyl)-1-(4-formylcyclohexyl)pyrazol-4-yl]-1,5-naphthyridine-4-carboxamide |
| SMILES | Nc1ccc2nccc(C(=O)Nc3cn(C4CCC(C=O)CC4)nc3C(F)F)c2n1 |
| InChI | InChI=1S/C20H20F2N6O2/c21-19(22)18-15(9-28(27-18)12-3-1-11(10-29)2-4-12)25-20(30)13-7-8-24-14-5-6-16(23)26-17(13)14/h5-12,19H,1-4H2,(H2,23,26)(H,25,30) |
| InChIKey | MPRWQVSCQWNFBT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|