C39H48F4N6O7 — CID 162465085
(2,3,4,6-tetrafluoro-5-hydroxyphenyl) 3-[2-[2-[[4-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butylcarbamoyl]cyclohexanecarbonyl]amino]ethoxy]ethoxy]propanoate (PubChem CID 162465085) has the molecular formula C39H48F4N6O7 and a molecular weight of 788.84 g/mol. Its IUPAC name is (2,3,4,6-tetrafluoro-5-hydroxyphenyl) 3-[2-[2-[[4-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butylcarbamoyl]cyclohexanecarbonyl]amino]ethoxy]ethoxy]propanoate.
| Compound Name | (2,3,4,6-tetrafluoro-5-hydroxyphenyl) 3-[2-[2-[[4-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butylcarbamoyl]cyclohexanecarbonyl]amino]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 162465085 |
| Molecular Formula | C39H48F4N6O7 |
| Molecular Weight | 788.84 g/mol |
| Exact Mass | 788.35 |
| IUPAC Name | (2,3,4,6-tetrafluoro-5-hydroxyphenyl) 3-[2-[2-[[4-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butylcarbamoyl]cyclohexanecarbonyl]amino]ethoxy]ethoxy]propanoate |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CCCCNC(=O)C1CCC(C(=O)NCCOCCOCCC(=O)Oc2c(F)c(O)c(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C39H48F4N6O7/c1-2-3-10-27-48-33-34(25-8-4-5-9-26(25)47-37(33)44)49(27)18-7-6-16-45-38(52)23-11-13-24(14-12-23)39(53)46-17-20-55-22-21-54-19-15-28(50)56-36-31(42)29(40)30(41)35(51)32(36)43/h4-5,8-9,23-24,51H,2-3,6-7,10-22H2,1H3,(H2,44,47)(H,45,52)(H,46,53) |
| InChIKey | RIUNQRBKMGQRPH-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 179.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.84 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|