C9H12N3O4Se — CID 162465121
CID 162465121 (PubChem CID 162465121) has the molecular formula C9H12N3O4Se and a molecular weight of 305.17 g/mol.
| Compound Name | CID 162465121 |
|---|---|
| PubChem CID | 162465121 |
| Molecular Formula | C9H12N3O4Se |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | — |
| SMILES | Nc1ccn([C@@H]2OC(CO)[C@H](O)C2[Se])c(=O)n1 |
| InChI | InChI=1S/C9H12N3O4Se/c10-5-1-2-12(9(15)11-5)8-7(17)6(14)4(3-13)16-8/h1-2,4,6-8,13-14H,3H2,(H2,10,11,15)/t4?,6-,7?,8+/m0/s1 |
| InChIKey | SYWXYOBDSHZKAU-UANZIBEISA-N |
| XLogP | -1.97 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|