C49H41N4O2Pt- — CID 162465906
2-tert-butyl-6-[4-tert-butyl-6-[6-(4-phenylphenyl)-2-pyridin-2-yl-1H-carbazol-1-id-9-yl]-2-pyridinyl]-1,3-benzoxazol-5-ol;platinum (PubChem CID 162465906) has the molecular formula C49H41N4O2Pt- and a molecular weight of 912.97 g/mol. Its IUPAC name is 2-tert-butyl-6-[4-tert-butyl-6-[6-(4-phenylphenyl)-2-pyridin-2-yl-1H-carbazol-1-id-9-yl]-2-pyridinyl]-1,3-benzoxazol-5-ol;platinum.
| Compound Name | 2-tert-butyl-6-[4-tert-butyl-6-[6-(4-phenylphenyl)-2-pyridin-2-yl-1H-carbazol-1-id-9-yl]-2-pyridinyl]-1,3-benzoxazol-5-ol;platinum |
|---|---|
| PubChem CID | 162465906 |
| Molecular Formula | C49H41N4O2Pt- |
| Molecular Weight | 912.97 g/mol |
| Exact Mass | 912.29 |
| IUPAC Name | 2-tert-butyl-6-[4-tert-butyl-6-[6-(4-phenylphenyl)-2-pyridin-2-yl-1H-carbazol-1-id-9-yl]-2-pyridinyl]-1,3-benzoxazol-5-ol;platinum |
| SMILES | CC(C)(C)c1cc(-c2cc3oc(C(C)(C)C)nc3cc2O)nc(-n2c3[c-]c(-c4ccccn4)ccc3c3cc(-c4ccc(-c5ccccc5)cc4)ccc32)c1.[Pt] |
| InChI | InChI=1S/C49H41N4O2.Pt/c1-48(2,3)35-26-40(38-28-45-41(29-44(38)54)52-47(55-45)49(4,5)6)51-46(27-35)53-42-22-20-33(32-17-15-31(16-18-32)30-12-8-7-9-13-30)24-37(42)36-21-19-34(25-43(36)53)39-14-10-11-23-50-39;/h7-24,26-29,54H,1-6H3;/q-1; |
| InChIKey | MATYKNUYAHEJQR-UHFFFAOYSA-N |
| XLogP | 12.48 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.97 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|