About 1-methylspiro[3H-indole-2,3'-benzo[f][1,4]benzoxazine]-9'-ol
1-methylspiro[3H-indole-2,3'-benzo[f][1,4]benzoxazine]-9'-ol (PubChem CID 162466024) has the molecular formula C20H16N2O2
and a molecular weight of 316.36 g/mol. Its IUPAC name is 1-methylspiro[3H-indole-2,3'-benzo[f][1,4]benzoxazine]-9'-ol.
Molecular Properties
| Compound Name | 1-methylspiro[3H-indole-2,3'-benzo[f][1,4]benzoxazine]-9'-ol |
| PubChem CID | 162466024 |
| Molecular Formula | C20H16N2O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 1-methylspiro[3H-indole-2,3'-benzo[f][1,4]benzoxazine]-9'-ol |
| SMILES | CN1c2ccccc2CC12C=Nc1c(ccc3ccc(O)cc13)O2 |
| InChI | InChI=1S/C20H16N2O2/c1-22-17-5-3-2-4-14(17)11-20(22)12-21-19-16-10-15(23)8-6-13(16)7-9-18(19)24-20/h2-10,12,23H,11H2,1H3 |
| InChIKey | XDYQDZYSQJLSLQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methylspiro[3H-indole-2,3'-benzo[f][1,4]benzoxazine]-9'-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylspiro[3H-indole-2,3'-benzo[f][1,4]benzoxazine]-9'-ol?
The IUPAC name of 1-methylspiro[3H-indole-2,3'-benzo[f][1,4]benzoxazine]-9'-ol (CID 162466024) is 1-methylspiro[3H-indole-2,3'-benzo[f][1,4]benzoxazine]-9'-ol.
What is the SMILES notation for 1-methylspiro[3H-indole-2,3'-benzo[f][1,4]benzoxazine]-9'-ol?
The canonical SMILES for 1-methylspiro[3H-indole-2,3'-benzo[f][1,4]benzoxazine]-9'-ol is CN1c2ccccc2CC12C=Nc1c(ccc3ccc(O)cc13)O2.
What is the InChIKey of 1-methylspiro[3H-indole-2,3'-benzo[f][1,4]benzoxazine]-9'-ol?
The InChIKey is XDYQDZYSQJLSLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N2O2/c1-22-17-5-3-2-4-14(17)11-20(22)12-21-19-16-10-15(23)8-6-13(16)7-9-18(19)24-20/h2-10,12,23H,11H2,1H3.
What are the key properties of 1-methylspiro[3H-indole-2,3'-benzo[f][1,4]benzoxazine]-9'-ol?
1-methylspiro[3H-indole-2,3'-benzo[f][1,4]benzoxazine]-9'-ol has a molecular weight of 316.36 g/mol, XLogP of 4.03, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylspiro[3H-indole-2,3'-benzo[f][1,4]benzoxazine]-9'-ol is sourced from PubChem (CID 162466024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).