C10H4F3I5NO4S- — CID 162466952
2-(2,3,4,5,6-pentaiodobenzoyl)oxyethyl-(trifluoromethylsulfonyl)azanide (PubChem CID 162466952) has the molecular formula C10H4F3I5NO4S- and a molecular weight of 925.73 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentaiodobenzoyl)oxyethyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | 2-(2,3,4,5,6-pentaiodobenzoyl)oxyethyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 162466952 |
| Molecular Formula | C10H4F3I5NO4S- |
| Molecular Weight | 925.73 g/mol |
| Exact Mass | 925.50 |
| IUPAC Name | 2-(2,3,4,5,6-pentaiodobenzoyl)oxyethyl-(trifluoromethylsulfonyl)azanide |
| SMILES | O=C(OCC[N-]S(=O)(=O)C(F)(F)F)c1c(I)c(I)c(I)c(I)c1I |
| InChI | InChI=1S/C10H4F3I5NO4S/c11-10(12,13)24(21,22)19-1-2-23-9(20)3-4(14)6(16)8(18)7(17)5(3)15/h1-2H2/q-1 |
| InChIKey | NMQGLXWUXUXPPV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 74.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.73 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|