C25H31N5O3S — CID 162467486
1-[(3-cyclopropyl-3,4,8-triazatricyclo[6.2.2.02,6]dodeca-2(6),4-dien-5-yl)sulfonyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 162467486) has the molecular formula C25H31N5O3S and a molecular weight of 481.62 g/mol. Its IUPAC name is 1-[(3-cyclopropyl-3,4,8-triazatricyclo[6.2.2.02,6]dodeca-2(6),4-dien-5-yl)sulfonyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-[(3-cyclopropyl-3,4,8-triazatricyclo[6.2.2.02,6]dodeca-2(6),4-dien-5-yl)sulfonyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 162467486 |
| Molecular Formula | C25H31N5O3S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 1-[(3-cyclopropyl-3,4,8-triazatricyclo[6.2.2.02,6]dodeca-2(6),4-dien-5-yl)sulfonyl]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | O=C(Nc1c2c(cc3c1CCC3)CCC2)NS(=O)(=O)c1nn(C2CC2)c2c1CN1CCC2CC1 |
| InChI | InChI=1S/C25H31N5O3S/c31-25(26-22-19-5-1-3-16(19)13-17-4-2-6-20(17)22)28-34(32,33)24-21-14-29-11-9-15(10-12-29)23(21)30(27-24)18-7-8-18/h13,15,18H,1-12,14H2,(H2,26,28,31) |
| InChIKey | SCORXEPUDOKUAS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |