C19H19NO3 — CID 162467507
(4aR,8aR)-6-benzoyl-4a-methyl-4,6,7,8,8a,9-hexahydrobenzo[f][1,2]benzoxazol-5-one (PubChem CID 162467507) has the molecular formula C19H19NO3 and a molecular weight of 309.36 g/mol. Its IUPAC name is (4aR,8aR)-6-benzoyl-4a-methyl-4,6,7,8,8a,9-hexahydrobenzo[f][1,2]benzoxazol-5-one.
| Compound Name | (4aR,8aR)-6-benzoyl-4a-methyl-4,6,7,8,8a,9-hexahydrobenzo[f][1,2]benzoxazol-5-one |
|---|---|
| PubChem CID | 162467507 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (4aR,8aR)-6-benzoyl-4a-methyl-4,6,7,8,8a,9-hexahydrobenzo[f][1,2]benzoxazol-5-one |
| SMILES | C[C@@]12Cc3cnoc3C[C@H]1CCC(C(=O)c1ccccc1)C2=O |
| InChI | InChI=1S/C19H19NO3/c1-19-10-13-11-20-23-16(13)9-14(19)7-8-15(18(19)22)17(21)12-5-3-2-4-6-12/h2-6,11,14-15H,7-10H2,1H3/t14-,15?,19-/m1/s1 |
| InChIKey | XGDRORITZIEQBV-NQUBZZJWSA-N |
| XLogP | 3.26 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|