C13H13Cl2N3O2 — CID 162467561
3-(4-amino-2,6-dichlorophenoxy)-5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1H-pyridazin-6-one (PubChem CID 162467561) has the molecular formula C13H13Cl2N3O2 and a molecular weight of 321.21 g/mol. Its IUPAC name is 3-(4-amino-2,6-dichlorophenoxy)-5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1H-pyridazin-6-one.
| Compound Name | 3-(4-amino-2,6-dichlorophenoxy)-5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 162467561 |
| Molecular Formula | C13H13Cl2N3O2 |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 3-(4-amino-2,6-dichlorophenoxy)-5-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1H-pyridazin-6-one |
| SMILES | [2H]C([2H])([2H])C([2H])(c1cc(Oc2c(Cl)cc(N)cc2Cl)n[nH]c1=O)C([2H])([2H])[2H] |
| InChI | InChI=1S/C13H13Cl2N3O2/c1-6(2)8-5-11(17-18-13(8)19)20-12-9(14)3-7(16)4-10(12)15/h3-6H,16H2,1-2H3,(H,18,19)/i1D3,2D3,6D |
| InChIKey | PFQNEKHHAFIRRV-NWOXSKRJSA-N |
| XLogP | 3.57 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|