C18H16F4N4O — CID 162467630
(6-fluoro-1,9-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanone (PubChem CID 162467630) has the molecular formula C18H16F4N4O and a molecular weight of 380.35 g/mol. Its IUPAC name is (6-fluoro-1,9-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanone.
| Compound Name | (6-fluoro-1,9-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 162467630 |
| Molecular Formula | C18H16F4N4O |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (6-fluoro-1,9-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-[5-(trifluoromethyl)-1H-pyrazol-3-yl]methanone |
| SMILES | Cc1ccc(F)c2[nH]c3c(c12)C(C)N(C(=O)c1cc(C(F)(F)F)[nH]n1)CC3 |
| InChI | InChI=1S/C18H16F4N4O/c1-8-3-4-10(19)16-14(8)15-9(2)26(6-5-11(15)23-16)17(27)12-7-13(25-24-12)18(20,21)22/h3-4,7,9,23H,5-6H2,1-2H3,(H,24,25) |
| InChIKey | VCLBFHAEHYVLJA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |