C49H63FO7S2 — CID 162467731
[(2R,3R,4S)-3-benzoyloxy-4-fluoro-2-hydroxy-5,5-bis[(4-octoxyphenyl)methylsulfanyl]pentyl] benzoate (PubChem CID 162467731) has the molecular formula C49H63FO7S2 and a molecular weight of 847.17 g/mol. Its IUPAC name is [(2R,3R,4S)-3-benzoyloxy-4-fluoro-2-hydroxy-5,5-bis[(4-octoxyphenyl)methylsulfanyl]pentyl] benzoate.
| Compound Name | [(2R,3R,4S)-3-benzoyloxy-4-fluoro-2-hydroxy-5,5-bis[(4-octoxyphenyl)methylsulfanyl]pentyl] benzoate |
|---|---|
| PubChem CID | 162467731 |
| Molecular Formula | C49H63FO7S2 |
| Molecular Weight | 847.17 g/mol |
| Exact Mass | 846.40 |
| IUPAC Name | [(2R,3R,4S)-3-benzoyloxy-4-fluoro-2-hydroxy-5,5-bis[(4-octoxyphenyl)methylsulfanyl]pentyl] benzoate |
| SMILES | CCCCCCCCOc1ccc(CSC(SCc2ccc(OCCCCCCCC)cc2)[C@@H](F)[C@H](OC(=O)c2ccccc2)[C@H](O)COC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C49H63FO7S2/c1-3-5-7-9-11-19-33-54-42-29-25-38(26-30-42)36-58-49(59-37-39-27-31-43(32-28-39)55-34-20-12-10-8-6-4-2)45(50)46(57-48(53)41-23-17-14-18-24-41)44(51)35-56-47(52)40-21-15-13-16-22-40/h13-18,21-32,44-46,49,51H,3-12,19-20,33-37H2,1-2H3/t44-,45+,46-/m1/s1 |
| InChIKey | DXBHJZUSRWULEA-ZUYNZICMSA-N |
| XLogP | 12.44 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.17 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|