C19H32O3 — CID 162467867
[(1S,2E,6S)-6-(2,2-dimethylpropanoyl)-6-methylcyclooct-2-en-1-yl] 2,2-dimethylpropanoate (PubChem CID 162467867) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is [(1S,2E,6S)-6-(2,2-dimethylpropanoyl)-6-methylcyclooct-2-en-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1S,2E,6S)-6-(2,2-dimethylpropanoyl)-6-methylcyclooct-2-en-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 162467867 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | [(1S,2E,6S)-6-(2,2-dimethylpropanoyl)-6-methylcyclooct-2-en-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@@H]1/C=C\CC[C@](C)(C(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C19H32O3/c1-17(2,3)15(20)19(7)12-9-8-10-14(11-13-19)22-16(21)18(4,5)6/h8,10,14H,9,11-13H2,1-7H3/b10-8-/t14-,19+/m1/s1 |
| InChIKey | GIBLERFFNLXWBN-OYKHKUDJSA-N |
| XLogP | 4.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|