C21H24BrNO2 — CID 162468501
(4aS,5R)-5-(2-bromo-3,6-dimethoxyphenyl)-9-isocyano-9-methyl-2,3,4,4a,5,8-hexahydrobenzo[7]annulene (PubChem CID 162468501) has the molecular formula C21H24BrNO2 and a molecular weight of 402.33 g/mol. Its IUPAC name is (4aS,5R)-5-(2-bromo-3,6-dimethoxyphenyl)-9-isocyano-9-methyl-2,3,4,4a,5,8-hexahydrobenzo[7]annulene.
| Compound Name | (4aS,5R)-5-(2-bromo-3,6-dimethoxyphenyl)-9-isocyano-9-methyl-2,3,4,4a,5,8-hexahydrobenzo[7]annulene |
|---|---|
| PubChem CID | 162468501 |
| Molecular Formula | C21H24BrNO2 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | (4aS,5R)-5-(2-bromo-3,6-dimethoxyphenyl)-9-isocyano-9-methyl-2,3,4,4a,5,8-hexahydrobenzo[7]annulene |
| SMILES | [C-]#[N+]C1(C)CC=C[C@@H](c2c(OC)ccc(OC)c2Br)[C@@H]2CCCC=C21 |
| InChI | InChI=1S/C21H24BrNO2/c1-21(23-2)13-7-9-15(14-8-5-6-10-16(14)21)19-17(24-3)11-12-18(25-4)20(19)22/h7,9-12,14-15H,5-6,8,13H2,1,3-4H3/t14-,15+,21?/m0/s1 |
| InChIKey | HHFPOTJKRJLEMF-ZOMUKPOZSA-N |
| XLogP | 5.91 |
| TPSA | 22.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|