C30H51FO4Si — CID 162468540
methyl (4R)-4-[(4R,5S,6R,7R,10R,13R)-6-ethyl-4-fluoro-10,13-dimethyl-3-oxo-7-trimethylsilyloxy-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 162468540) has the molecular formula C30H51FO4Si and a molecular weight of 522.82 g/mol. Its IUPAC name is methyl (4R)-4-[(4R,5S,6R,7R,10R,13R)-6-ethyl-4-fluoro-10,13-dimethyl-3-oxo-7-trimethylsilyloxy-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(4R,5S,6R,7R,10R,13R)-6-ethyl-4-fluoro-10,13-dimethyl-3-oxo-7-trimethylsilyloxy-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 162468540 |
| Molecular Formula | C30H51FO4Si |
| Molecular Weight | 522.82 g/mol |
| Exact Mass | 522.35 |
| IUPAC Name | methyl (4R)-4-[(4R,5S,6R,7R,10R,13R)-6-ethyl-4-fluoro-10,13-dimethyl-3-oxo-7-trimethylsilyloxy-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | CC[C@H]1C(O[Si](C)(C)C)C2C3CCC([C@H](C)CCC(=O)OC)[C@@]3(C)CCC2[C@@]2(C)CCC(=O)[C@H](F)[C@@H]12 |
| InChI | InChI=1S/C30H51FO4Si/c1-9-19-26-27(31)23(32)15-17-30(26,4)22-14-16-29(3)20(18(2)10-13-24(33)34-5)11-12-21(29)25(22)28(19)35-36(6,7)8/h18-22,25-28H,9-17H2,1-8H3/t18-,19-,20?,21?,22?,25?,26-,27+,28?,29-,30-/m1/s1 |
| InChIKey | RNMVBXZOCVNLSX-TVOVIVRESA-N |
| XLogP | 7.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.82 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|