C24H20AuN4-2 — CID 162468805
gold;5,10,15,20-tetramethylporphyrin-22,24-diide (PubChem CID 162468805) has the molecular formula C24H20AuN4-2 and a molecular weight of 561.42 g/mol. Its IUPAC name is gold;5,10,15,20-tetramethylporphyrin-22,24-diide.
| Compound Name | gold;5,10,15,20-tetramethylporphyrin-22,24-diide |
|---|---|
| PubChem CID | 162468805 |
| Molecular Formula | C24H20AuN4-2 |
| Molecular Weight | 561.42 g/mol |
| Exact Mass | 561.14 |
| IUPAC Name | gold;5,10,15,20-tetramethylporphyrin-22,24-diide |
| SMILES | Cc1c2nc(c(C)c3ccc([n-]3)c(C)c3nc(c(C)c4ccc1[n-]4)C=C3)C=C2.[Au] |
| InChI | InChI=1S/C24H20N4.Au/c1-13-17-5-7-19(25-17)14(2)21-9-11-23(27-21)16(4)24-12-10-22(28-24)15(3)20-8-6-18(13)26-20;/h5-12H,1-4H3;/q-2;/b17-13-,18-13-,19-14-,20-15-,21-14-,22-15-,23-16-,24-16-; |
| InChIKey | NJODWHUKPSNMQP-UAXVPCMMSA-N |
| XLogP | 5.14 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |