C23H38O2Si — CID 162469472
(2E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)-5-trimethylsilyloxynona-2,6,8-trienal (PubChem CID 162469472) has the molecular formula C23H38O2Si and a molecular weight of 374.64 g/mol. Its IUPAC name is (2E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)-5-trimethylsilyloxynona-2,6,8-trienal.
| Compound Name | (2E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)-5-trimethylsilyloxynona-2,6,8-trienal |
|---|---|
| PubChem CID | 162469472 |
| Molecular Formula | C23H38O2Si |
| Molecular Weight | 374.64 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | (2E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)-5-trimethylsilyloxynona-2,6,8-trienal |
| SMILES | CC1=C(/C=C/C(C)=C/C(C/C(C)=C/C=O)O[Si](C)(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C23H38O2Si/c1-18(11-12-22-20(3)10-9-14-23(22,4)5)16-21(25-26(6,7)8)17-19(2)13-15-24/h11-13,15-16,21H,9-10,14,17H2,1-8H3/b12-11+,18-16+,19-13+ |
| InChIKey | ARNXPZNRABMGIT-OAKKJWGMSA-N |
| XLogP | 6.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.64 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|