About 1-(7-chlorothieno[3,2-b]pyridin-2-yl)propan-2-ol
1-(7-chlorothieno[3,2-b]pyridin-2-yl)propan-2-ol (PubChem CID 162469989) has the molecular formula C10H10ClNOS
and a molecular weight of 227.72 g/mol. Its IUPAC name is 1-(7-chlorothieno[3,2-b]pyridin-2-yl)propan-2-ol.
Molecular Properties
| Compound Name | 1-(7-chlorothieno[3,2-b]pyridin-2-yl)propan-2-ol |
| PubChem CID | 162469989 |
| Molecular Formula | C10H10ClNOS |
| Molecular Weight | 227.72 g/mol |
| Exact Mass | 227.02 |
| IUPAC Name | 1-(7-chlorothieno[3,2-b]pyridin-2-yl)propan-2-ol |
| SMILES | CC(O)Cc1cc2nccc(Cl)c2s1 |
| InChI | InChI=1S/C10H10ClNOS/c1-6(13)4-7-5-9-10(14-7)8(11)2-3-12-9/h2-3,5-6,13H,4H2,1H3 |
| InChIKey | SYTHTMFLAQXWAS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.72 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(7-chlorothieno[3,2-b]pyridin-2-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-chlorothieno[3,2-b]pyridin-2-yl)propan-2-ol?
The IUPAC name of 1-(7-chlorothieno[3,2-b]pyridin-2-yl)propan-2-ol (CID 162469989) is 1-(7-chlorothieno[3,2-b]pyridin-2-yl)propan-2-ol.
What is the SMILES notation for 1-(7-chlorothieno[3,2-b]pyridin-2-yl)propan-2-ol?
The canonical SMILES for 1-(7-chlorothieno[3,2-b]pyridin-2-yl)propan-2-ol is CC(O)Cc1cc2nccc(Cl)c2s1.
What is the InChIKey of 1-(7-chlorothieno[3,2-b]pyridin-2-yl)propan-2-ol?
The InChIKey is SYTHTMFLAQXWAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClNOS/c1-6(13)4-7-5-9-10(14-7)8(11)2-3-12-9/h2-3,5-6,13H,4H2,1H3.
What are the key properties of 1-(7-chlorothieno[3,2-b]pyridin-2-yl)propan-2-ol?
1-(7-chlorothieno[3,2-b]pyridin-2-yl)propan-2-ol has a molecular weight of 227.72 g/mol, XLogP of 2.87, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-chlorothieno[3,2-b]pyridin-2-yl)propan-2-ol is sourced from PubChem (CID 162469989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).