About N-(1-adamantyl)-2-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)oxyacetamide
N-(1-adamantyl)-2-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)oxyacetamide (PubChem CID 162470260) has the molecular formula C19H27N3O2S
and a molecular weight of 361.51 g/mol. Its IUPAC name is N-(1-adamantyl)-2-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)oxyacetamide.
Molecular Properties
| Compound Name | N-(1-adamantyl)-2-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)oxyacetamide |
| PubChem CID | 162470260 |
| Molecular Formula | C19H27N3O2S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-(1-adamantyl)-2-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)oxyacetamide |
| SMILES | CSc1nc(C)c(C)c(OCC(=O)NC23CC4CC(CC(C4)C2)C3)n1 |
| InChI | InChI=1S/C19H27N3O2S/c1-11-12(2)20-18(25-3)21-17(11)24-10-16(23)22-19-7-13-4-14(8-19)6-15(5-13)9-19/h13-15H,4-10H2,1-3H3,(H,22,23) |
| InChIKey | XTPLFPGOULGHNR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1-adamantyl)-2-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)oxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-adamantyl)-2-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)oxyacetamide?
The IUPAC name of N-(1-adamantyl)-2-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)oxyacetamide (CID 162470260) is N-(1-adamantyl)-2-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)oxyacetamide.
What is the SMILES notation for N-(1-adamantyl)-2-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)oxyacetamide?
The canonical SMILES for N-(1-adamantyl)-2-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)oxyacetamide is CSc1nc(C)c(C)c(OCC(=O)NC23CC4CC(CC(C4)C2)C3)n1.
What is the InChIKey of N-(1-adamantyl)-2-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)oxyacetamide?
The InChIKey is XTPLFPGOULGHNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N3O2S/c1-11-12(2)20-18(25-3)21-17(11)24-10-16(23)22-19-7-13-4-14(8-19)6-15(5-13)9-19/h13-15H,4-10H2,1-3H3,(H,22,23).
What are the key properties of N-(1-adamantyl)-2-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)oxyacetamide?
N-(1-adamantyl)-2-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)oxyacetamide has a molecular weight of 361.51 g/mol, XLogP of 3.28, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-adamantyl)-2-(5,6-dimethyl-2-methylsulfanylpyrimidin-4-yl)oxyacetamide is sourced from PubChem (CID 162470260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).