C26H29FN2OS — CID 162470484
(1S,2R,13R,14S,18S)-7-(4-fluoroanilino)-2,18-dimethyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-one (PubChem CID 162470484) has the molecular formula C26H29FN2OS and a molecular weight of 436.60 g/mol. Its IUPAC name is (1S,2R,13R,14S,18S)-7-(4-fluoroanilino)-2,18-dimethyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-one.
| Compound Name | (1S,2R,13R,14S,18S)-7-(4-fluoroanilino)-2,18-dimethyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-one |
|---|---|
| PubChem CID | 162470484 |
| Molecular Formula | C26H29FN2OS |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | (1S,2R,13R,14S,18S)-7-(4-fluoroanilino)-2,18-dimethyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-17-one |
| SMILES | C[C@]12CCc3nc(Nc4ccc(F)cc4)sc3C1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C26H29FN2OS/c1-25-14-12-21-23(31-24(29-21)28-16-5-3-15(27)4-6-16)20(25)8-7-17-18-9-10-22(30)26(18,2)13-11-19(17)25/h3-6,8,17-19H,7,9-14H2,1-2H3,(H,28,29)/t17-,18-,19-,25+,26-/m0/s1 |
| InChIKey | RXXYXIVUIYKXMU-MMUXUBNZSA-N |
| XLogP | 6.78 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |