About (acetamido-oxo-propan-2-yl-λ6-sulfanylidene)tungsten
(acetamido-oxo-propan-2-yl-λ6-sulfanylidene)tungsten (PubChem CID 162470603) has the molecular formula C5H11NO2SW
and a molecular weight of 333.06 g/mol. Its IUPAC name is (acetamido-oxo-propan-2-yl-λ6-sulfanylidene)tungsten.
Molecular Properties
| Compound Name | (acetamido-oxo-propan-2-yl-λ6-sulfanylidene)tungsten |
| PubChem CID | 162470603 |
| Molecular Formula | C5H11NO2SW |
| Molecular Weight | 333.06 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | (acetamido-oxo-propan-2-yl-λ6-sulfanylidene)tungsten |
| SMILES | CC(=O)NS(=O)(=[W])C(C)C |
| InChI | InChI=1S/C5H11NO2S.W/c1-4(2)9(8)6-5(3)7;/h4H,1-3H3,(H,6,7); |
| InChIKey | ILZBLEWAZAXERM-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.06 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (acetamido-oxo-propan-2-yl-λ6-sulfanylidene)tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (acetamido-oxo-propan-2-yl-λ6-sulfanylidene)tungsten?
The IUPAC name of (acetamido-oxo-propan-2-yl-λ6-sulfanylidene)tungsten (CID 162470603) is (acetamido-oxo-propan-2-yl-λ6-sulfanylidene)tungsten.
What is the SMILES notation for (acetamido-oxo-propan-2-yl-λ6-sulfanylidene)tungsten?
The canonical SMILES for (acetamido-oxo-propan-2-yl-λ6-sulfanylidene)tungsten is CC(=O)NS(=O)(=[W])C(C)C.
What is the InChIKey of (acetamido-oxo-propan-2-yl-λ6-sulfanylidene)tungsten?
The InChIKey is ILZBLEWAZAXERM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2S.W/c1-4(2)9(8)6-5(3)7;/h4H,1-3H3,(H,6,7);.
What are the key properties of (acetamido-oxo-propan-2-yl-λ6-sulfanylidene)tungsten?
(acetamido-oxo-propan-2-yl-λ6-sulfanylidene)tungsten has a molecular weight of 333.06 g/mol, XLogP of 0.19, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (acetamido-oxo-propan-2-yl-λ6-sulfanylidene)tungsten is sourced from PubChem (CID 162470603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).