About 2-(1-hydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-carboxamide
2-(1-hydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 162470686) has the molecular formula C8H12N2O2S
and a molecular weight of 200.26 g/mol. Its IUPAC name is 2-(1-hydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-(1-hydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 162470686 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 2-(1-hydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C(C)CO)sc1C(N)=O |
| InChI | InChI=1S/C8H12N2O2S/c1-4(3-11)8-10-5(2)6(13-8)7(9)12/h4,11H,3H2,1-2H3,(H2,9,12) |
| InChIKey | DBNHPKAVUBHCCM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1-hydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-hydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-carboxamide?
The IUPAC name of 2-(1-hydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-carboxamide (CID 162470686) is 2-(1-hydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 2-(1-hydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for 2-(1-hydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-carboxamide is Cc1nc(C(C)CO)sc1C(N)=O.
What is the InChIKey of 2-(1-hydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-carboxamide?
The InChIKey is DBNHPKAVUBHCCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S/c1-4(3-11)8-10-5(2)6(13-8)7(9)12/h4,11H,3H2,1-2H3,(H2,9,12).
What are the key properties of 2-(1-hydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-carboxamide?
2-(1-hydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-carboxamide has a molecular weight of 200.26 g/mol, XLogP of 0.65, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hydroxypropan-2-yl)-4-methyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 162470686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).