C16H25N5O2 — CID 162471195
(4-aminopiperidin-1-yl)-[6-(oxan-2-ylmethylamino)pyrimidin-4-yl]methanone (PubChem CID 162471195) has the molecular formula C16H25N5O2 and a molecular weight of 319.41 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-[6-(oxan-2-ylmethylamino)pyrimidin-4-yl]methanone.
| Compound Name | (4-aminopiperidin-1-yl)-[6-(oxan-2-ylmethylamino)pyrimidin-4-yl]methanone |
|---|---|
| PubChem CID | 162471195 |
| Molecular Formula | C16H25N5O2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | (4-aminopiperidin-1-yl)-[6-(oxan-2-ylmethylamino)pyrimidin-4-yl]methanone |
| SMILES | NC1CCN(C(=O)c2cc(NCC3CCCCO3)ncn2)CC1 |
| InChI | InChI=1S/C16H25N5O2/c17-12-4-6-21(7-5-12)16(22)14-9-15(20-11-19-14)18-10-13-3-1-2-8-23-13/h9,11-13H,1-8,10,17H2,(H,18,19,20) |
| InChIKey | JKDVBOHICPSQNN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |