C12H21BN2O4 — CID 162471220
4-N,4-N,5-N,5-N-tetramethyl-2-[(1R,2R)-2-methylcyclopropyl]-1,3,2-dioxaborolane-4,5-dicarboxamide (PubChem CID 162471220) has the molecular formula C12H21BN2O4 and a molecular weight of 268.12 g/mol. Its IUPAC name is 4-N,4-N,5-N,5-N-tetramethyl-2-[(1R,2R)-2-methylcyclopropyl]-1,3,2-dioxaborolane-4,5-dicarboxamide.
| Compound Name | 4-N,4-N,5-N,5-N-tetramethyl-2-[(1R,2R)-2-methylcyclopropyl]-1,3,2-dioxaborolane-4,5-dicarboxamide |
|---|---|
| PubChem CID | 162471220 |
| Molecular Formula | C12H21BN2O4 |
| Molecular Weight | 268.12 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 4-N,4-N,5-N,5-N-tetramethyl-2-[(1R,2R)-2-methylcyclopropyl]-1,3,2-dioxaborolane-4,5-dicarboxamide |
| SMILES | C[C@@H]1C[C@H]1B1OC(C(=O)N(C)C)C(C(=O)N(C)C)O1 |
| InChI | InChI=1S/C12H21BN2O4/c1-7-6-8(7)13-18-9(11(16)14(2)3)10(19-13)12(17)15(4)5/h7-10H,6H2,1-5H3/t7-,8-,9?,10?/m1/s1 |
| InChIKey | WPKCRLJGWYUDNX-LGUIWLBCSA-N |
| XLogP | -0.16 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.12 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|