C33H18ClN3O2 — CID 162471283
2-(7-chlorodibenzofuran-3-yl)-4-dibenzofuran-1-yl-6-phenyl-1,3,5-triazine (PubChem CID 162471283) has the molecular formula C33H18ClN3O2 and a molecular weight of 523.98 g/mol. Its IUPAC name is 2-(7-chlorodibenzofuran-3-yl)-4-dibenzofuran-1-yl-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(7-chlorodibenzofuran-3-yl)-4-dibenzofuran-1-yl-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 162471283 |
| Molecular Formula | C33H18ClN3O2 |
| Molecular Weight | 523.98 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | 2-(7-chlorodibenzofuran-3-yl)-4-dibenzofuran-1-yl-6-phenyl-1,3,5-triazine |
| SMILES | Clc1ccc2c(c1)oc1cc(-c3nc(-c4ccccc4)nc(-c4cccc5oc6ccccc6c45)n3)ccc12 |
| InChI | InChI=1S/C33H18ClN3O2/c34-21-14-16-23-22-15-13-20(17-28(22)39-29(23)18-21)32-35-31(19-7-2-1-3-8-19)36-33(37-32)25-10-6-12-27-30(25)24-9-4-5-11-26(24)38-27/h1-18H |
| InChIKey | WSQPVQWNEOCPCF-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.98 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |