C10H25N5 — CID 162471610
1-(2-aminoethyl)-2-[3-(dimethylamino)propyl]-3-ethylguanidine (PubChem CID 162471610) has the molecular formula C10H25N5 and a molecular weight of 215.34 g/mol. Its IUPAC name is 1-(2-aminoethyl)-2-[3-(dimethylamino)propyl]-3-ethylguanidine.
| Compound Name | 1-(2-aminoethyl)-2-[3-(dimethylamino)propyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 162471610 |
| Molecular Formula | C10H25N5 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.21 |
| IUPAC Name | 1-(2-aminoethyl)-2-[3-(dimethylamino)propyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CCCN(C)C)NCCN |
| InChI | InChI=1S/C10H25N5/c1-4-12-10(14-8-6-11)13-7-5-9-15(2)3/h4-9,11H2,1-3H3,(H2,12,13,14) |
| InChIKey | CJDUFEMVNNPPSB-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|