C17H11F2I3O9S — CID 162472043
1,1-difluoro-2-oxo-2-[[5-oxo-9-(2,3,5-triiodobenzoyl)oxy-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]ethanesulfonic acid (PubChem CID 162472043) has the molecular formula C17H11F2I3O9S and a molecular weight of 810.04 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-[[5-oxo-9-(2,3,5-triiodobenzoyl)oxy-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-[[5-oxo-9-(2,3,5-triiodobenzoyl)oxy-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 162472043 |
| Molecular Formula | C17H11F2I3O9S |
| Molecular Weight | 810.04 g/mol |
| Exact Mass | 809.72 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-[[5-oxo-9-(2,3,5-triiodobenzoyl)oxy-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]ethanesulfonic acid |
| SMILES | O=C(OC1C2CC3C(OC(=O)C31)C2OC(=O)C(F)(F)S(=O)(=O)O)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C17H11F2I3O9S/c18-17(19,32(26,27)28)16(25)31-13-7-3-5-9(15(24)30-12(5)13)11(7)29-14(23)6-1-4(20)2-8(21)10(6)22/h1-2,5,7,9,11-13H,3H2,(H,26,27,28) |
| InChIKey | UZCIUGKZLQZLFK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.04 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|