C42H38ClFN6O8 — CID 162472079
5-[2-[5-[4-[6-chloro-8-fluoro-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]piperazin-1-yl]-5-oxopentoxy]ethoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 162472079) has the molecular formula C42H38ClFN6O8 and a molecular weight of 809.25 g/mol. Its IUPAC name is 5-[2-[5-[4-[6-chloro-8-fluoro-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]piperazin-1-yl]-5-oxopentoxy]ethoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[2-[5-[4-[6-chloro-8-fluoro-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]piperazin-1-yl]-5-oxopentoxy]ethoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 162472079 |
| Molecular Formula | C42H38ClFN6O8 |
| Molecular Weight | 809.25 g/mol |
| Exact Mass | 808.24 |
| IUPAC Name | 5-[2-[5-[4-[6-chloro-8-fluoro-7-(3-hydroxynaphthalen-1-yl)quinazolin-4-yl]piperazin-1-yl]-5-oxopentoxy]ethoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(OCCOCCCCC(=O)N4CCN(c5ncnc6c(F)c(-c7cc(O)cc8ccccc78)c(Cl)cc56)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C42H38ClFN6O8/c43-32-22-31-38(37(44)36(32)29-20-25(51)19-24-5-1-2-6-27(24)29)45-23-46-39(31)49-14-12-48(13-15-49)35(53)7-3-4-16-57-17-18-58-26-8-9-28-30(21-26)42(56)50(41(28)55)33-10-11-34(52)47-40(33)54/h1-2,5-6,8-9,19-23,33,51H,3-4,7,10-18H2,(H,47,52,54) |
| InChIKey | MGFUJKLPZJKIPA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 171.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.25 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|