C17H17FIN5O — CID 162474625
N-[2-(4-fluorophenyl)ethyl]-2-iodo-8,8-dimethyl-7H-purino[8,9-b][1,3]oxazol-4-amine (PubChem CID 162474625) has the molecular formula C17H17FIN5O and a molecular weight of 453.26 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-2-iodo-8,8-dimethyl-7H-purino[8,9-b][1,3]oxazol-4-amine.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-2-iodo-8,8-dimethyl-7H-purino[8,9-b][1,3]oxazol-4-amine |
|---|---|
| PubChem CID | 162474625 |
| Molecular Formula | C17H17FIN5O |
| Molecular Weight | 453.26 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-2-iodo-8,8-dimethyl-7H-purino[8,9-b][1,3]oxazol-4-amine |
| SMILES | CC1(C)COc2nc3c(NCCc4ccc(F)cc4)nc(I)nc3n21 |
| InChI | InChI=1S/C17H17FIN5O/c1-17(2)9-25-16-21-12-13(22-15(19)23-14(12)24(16)17)20-8-7-10-3-5-11(18)6-4-10/h3-6H,7-9H2,1-2H3,(H,20,22,23) |
| InChIKey | SHQLIARIWVDFKO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|