C38H35BFN11O10P+ — CID 162474855
CID 162474855 (PubChem CID 162474855) has the molecular formula C38H35BFN11O10P+ and a molecular weight of 866.55 g/mol.
| Compound Name | CID 162474855 |
|---|---|
| PubChem CID | 162474855 |
| Molecular Formula | C38H35BFN11O10P+ |
| Molecular Weight | 866.55 g/mol |
| Exact Mass | 866.24 |
| IUPAC Name | — |
| SMILES | [B][P+](OCC[N+]#[C-])(OC[C@H]1O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@@H](F)C1O)O[C@@H]1C2OC[C@]1(CO)O[C@H]2n1cnc2c(NC(=O)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C38H35BFN11O10P/c1-41-12-13-57-62(39,58-14-23-27(53)24(40)36(59-23)50-19-46-25-30(42-17-44-32(25)50)48-34(54)21-8-4-2-5-9-21)61-29-28-37(60-38(29,15-52)16-56-28)51-20-47-26-31(43-18-45-33(26)51)49-35(55)22-10-6-3-7-11-22/h2-11,17-20,23-24,27-29,36-37,52-53H,12-16H2,(H,42,44,48,54)(H,43,45,49,55)/q+1/t23-,24+,27?,28?,29-,36-,37-,38+,62?/m1/s1 |
| InChIKey | LHSKRLNBJVNEHH-OOKOJHJSSA-N |
| XLogP | 2.61 |
| TPSA | 245.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.55 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|