C24H34ClNO4 — CID 162475648
4-chloro-2-[(2E,4E)-5-[(1R,2R,3E,6R)-3-hydroxyimino-1,2,6-trimethylcyclohexyl]-3-methylpenta-2,4-dienyl]-3,6-dimethoxy-5-methylphenol (PubChem CID 162475648) has the molecular formula C24H34ClNO4 and a molecular weight of 435.99 g/mol. Its IUPAC name is 4-chloro-2-[(2E,4E)-5-[(1R,2R,3E,6R)-3-hydroxyimino-1,2,6-trimethylcyclohexyl]-3-methylpenta-2,4-dienyl]-3,6-dimethoxy-5-methylphenol.
| Compound Name | 4-chloro-2-[(2E,4E)-5-[(1R,2R,3E,6R)-3-hydroxyimino-1,2,6-trimethylcyclohexyl]-3-methylpenta-2,4-dienyl]-3,6-dimethoxy-5-methylphenol |
|---|---|
| PubChem CID | 162475648 |
| Molecular Formula | C24H34ClNO4 |
| Molecular Weight | 435.99 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 4-chloro-2-[(2E,4E)-5-[(1R,2R,3E,6R)-3-hydroxyimino-1,2,6-trimethylcyclohexyl]-3-methylpenta-2,4-dienyl]-3,6-dimethoxy-5-methylphenol |
| SMILES | COc1c(C)c(Cl)c(OC)c(C/C=C(C)/C=C/[C@@]2(C)[C@H](C)CC/C(=N\O)[C@@H]2C)c1O |
| InChI | InChI=1S/C24H34ClNO4/c1-14(12-13-24(5)15(2)9-11-19(26-28)17(24)4)8-10-18-21(27)22(29-6)16(3)20(25)23(18)30-7/h8,12-13,15,17,27-28H,9-11H2,1-7H3/b13-12+,14-8+,26-19+/t15-,17+,24+/m1/s1 |
| InChIKey | JGWBWWILLOBXJW-YRNAIVTCSA-N |
| XLogP | 6.32 |
| TPSA | 71.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.99 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|