About 2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzenesulfonamide
2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzenesulfonamide (PubChem CID 162476581) has the molecular formula C13H10FN3O3S
and a molecular weight of 307.31 g/mol. Its IUPAC name is 2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzenesulfonamide.
Molecular Properties
| Compound Name | 2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzenesulfonamide |
| PubChem CID | 162476581 |
| Molecular Formula | C13H10FN3O3S |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Oc2cnc3[nH]ccc3c2)cc1F |
| InChI | InChI=1S/C13H10FN3O3S/c14-11-6-9(1-2-12(11)21(15,18)19)20-10-5-8-3-4-16-13(8)17-7-10/h1-7H,(H,16,17)(H2,15,18,19) |
| InChIKey | OTTXCNUWHNDOKB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzenesulfonamide?
The IUPAC name of 2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzenesulfonamide (CID 162476581) is 2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzenesulfonamide.
What is the SMILES notation for 2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzenesulfonamide?
The canonical SMILES for 2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzenesulfonamide is NS(=O)(=O)c1ccc(Oc2cnc3[nH]ccc3c2)cc1F.
What is the InChIKey of 2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzenesulfonamide?
The InChIKey is OTTXCNUWHNDOKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10FN3O3S/c14-11-6-9(1-2-12(11)21(15,18)19)20-10-5-8-3-4-16-13(8)17-7-10/h1-7H,(H,16,17)(H2,15,18,19).
What are the key properties of 2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzenesulfonamide?
2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzenesulfonamide has a molecular weight of 307.31 g/mol, XLogP of 2.14, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzenesulfonamide is sourced from PubChem (CID 162476581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).