C13H14O42P10-20 — CID 162477310
[2-[(2,3,4,5,6-pentaphosphonatooxycyclohexyl)oxymethoxy]-3,4,5,6-tetraphosphonatooxycyclohexyl] phosphate (PubChem CID 162477310) has the molecular formula C13H14O42P10-20 and a molecular weight of 1151.95 g/mol. Its IUPAC name is [2-[(2,3,4,5,6-pentaphosphonatooxycyclohexyl)oxymethoxy]-3,4,5,6-tetraphosphonatooxycyclohexyl] phosphate.
| Compound Name | [2-[(2,3,4,5,6-pentaphosphonatooxycyclohexyl)oxymethoxy]-3,4,5,6-tetraphosphonatooxycyclohexyl] phosphate |
|---|---|
| PubChem CID | 162477310 |
| Molecular Formula | C13H14O42P10-20 |
| Molecular Weight | 1151.95 g/mol |
| Exact Mass | 1151.64 |
| IUPAC Name | [2-[(2,3,4,5,6-pentaphosphonatooxycyclohexyl)oxymethoxy]-3,4,5,6-tetraphosphonatooxycyclohexyl] phosphate |
| SMILES | O=P([O-])([O-])OC1C(OCOC2C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C2OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C1OP(=O)([O-])[O-] |
| InChI | InChI=1S/C13H34O42P10/c14-56(15,16)46-4-2(5(47-57(17,18)19)9(51-61(29,30)31)12(54-64(38,39)40)8(4)50-60(26,27)28)44-1-45-3-6(48-58(20,21)22)10(52-62(32,33)34)13(55-65(41,42)43)11(53-63(35,36)37)7(3)49-59(23,24)25/h2-13H,1H2,(H2,14,15,16)(H2,17,18,19)(H2,20,21,22)(H2,23,24,25)(H2,26,27,28)(H2,29,30,31)(H2,32,33,34)(H2,35,36,37)(H2,38,39,40)(H2,41,42,43)/p-20 |
| InChIKey | ZZZCGPYPOCVYOO-UHFFFAOYSA-A |
| XLogP | -18.12 |
| TPSA | 742.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 42 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1151.95 |
| LogP ≤ 5 | -18.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 42 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|