About 4-[(5,8-dimethyl-6-oxo-7-propyl-7H-pteridin-2-yl)amino]benzenesulfonamide
4-[(5,8-dimethyl-6-oxo-7-propyl-7H-pteridin-2-yl)amino]benzenesulfonamide (PubChem CID 162477913) has the molecular formula C17H22N6O3S
and a molecular weight of 390.47 g/mol. Its IUPAC name is 4-[(5,8-dimethyl-6-oxo-7-propyl-7H-pteridin-2-yl)amino]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[(5,8-dimethyl-6-oxo-7-propyl-7H-pteridin-2-yl)amino]benzenesulfonamide |
| PubChem CID | 162477913 |
| Molecular Formula | C17H22N6O3S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 4-[(5,8-dimethyl-6-oxo-7-propyl-7H-pteridin-2-yl)amino]benzenesulfonamide |
| SMILES | CCCC1C(=O)N(C)c2cnc(Nc3ccc(S(N)(=O)=O)cc3)nc2N1C |
| InChI | InChI=1S/C17H22N6O3S/c1-4-5-13-16(24)23(3)14-10-19-17(21-15(14)22(13)2)20-11-6-8-12(9-7-11)27(18,25)26/h6-10,13H,4-5H2,1-3H3,(H2,18,25,26)(H,19,20,21) |
| InChIKey | IMHMEFKERQOTPM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[(5,8-dimethyl-6-oxo-7-propyl-7H-pteridin-2-yl)amino]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5,8-dimethyl-6-oxo-7-propyl-7H-pteridin-2-yl)amino]benzenesulfonamide?
The IUPAC name of 4-[(5,8-dimethyl-6-oxo-7-propyl-7H-pteridin-2-yl)amino]benzenesulfonamide (CID 162477913) is 4-[(5,8-dimethyl-6-oxo-7-propyl-7H-pteridin-2-yl)amino]benzenesulfonamide.
What is the SMILES notation for 4-[(5,8-dimethyl-6-oxo-7-propyl-7H-pteridin-2-yl)amino]benzenesulfonamide?
The canonical SMILES for 4-[(5,8-dimethyl-6-oxo-7-propyl-7H-pteridin-2-yl)amino]benzenesulfonamide is CCCC1C(=O)N(C)c2cnc(Nc3ccc(S(N)(=O)=O)cc3)nc2N1C.
What is the InChIKey of 4-[(5,8-dimethyl-6-oxo-7-propyl-7H-pteridin-2-yl)amino]benzenesulfonamide?
The InChIKey is IMHMEFKERQOTPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N6O3S/c1-4-5-13-16(24)23(3)14-10-19-17(21-15(14)22(13)2)20-11-6-8-12(9-7-11)27(18,25)26/h6-10,13H,4-5H2,1-3H3,(H2,18,25,26)(H,19,20,21).
What are the key properties of 4-[(5,8-dimethyl-6-oxo-7-propyl-7H-pteridin-2-yl)amino]benzenesulfonamide?
4-[(5,8-dimethyl-6-oxo-7-propyl-7H-pteridin-2-yl)amino]benzenesulfonamide has a molecular weight of 390.47 g/mol, XLogP of 1.45, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5,8-dimethyl-6-oxo-7-propyl-7H-pteridin-2-yl)amino]benzenesulfonamide is sourced from PubChem (CID 162477913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).