C21H24ClN3O4S — CID 162479693
[(2S,4R)-4-(8-chloro-2-cyclobutylimidazo[4,5-c]quinolin-1-yl)oxan-2-yl]methyl methanesulfonate (PubChem CID 162479693) has the molecular formula C21H24ClN3O4S and a molecular weight of 449.96 g/mol. Its IUPAC name is [(2S,4R)-4-(8-chloro-2-cyclobutylimidazo[4,5-c]quinolin-1-yl)oxan-2-yl]methyl methanesulfonate.
| Compound Name | [(2S,4R)-4-(8-chloro-2-cyclobutylimidazo[4,5-c]quinolin-1-yl)oxan-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 162479693 |
| Molecular Formula | C21H24ClN3O4S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | [(2S,4R)-4-(8-chloro-2-cyclobutylimidazo[4,5-c]quinolin-1-yl)oxan-2-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@H]1C[C@H](n2c(C3CCC3)nc3cnc4ccc(Cl)cc4c32)CCO1 |
| InChI | InChI=1S/C21H24ClN3O4S/c1-30(26,27)29-12-16-10-15(7-8-28-16)25-20-17-9-14(22)5-6-18(17)23-11-19(20)24-21(25)13-3-2-4-13/h5-6,9,11,13,15-16H,2-4,7-8,10,12H2,1H3/t15-,16+/m1/s1 |
| InChIKey | RDFMHRPJUYDWFL-CVEARBPZSA-N |
| XLogP | 4.20 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|